C19H28O6 — CID 157296266
6-phenyl-1,4,7,10,13-pentaoxacyclooctadecan-2-one (PubChem CID 157296266) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 6-phenyl-1,4,7,10,13-pentaoxacyclooctadecan-2-one.
| Compound Name | 6-phenyl-1,4,7,10,13-pentaoxacyclooctadecan-2-one |
|---|---|
| PubChem CID | 157296266 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 6-phenyl-1,4,7,10,13-pentaoxacyclooctadecan-2-one |
| SMILES | O=C1COCC(c2ccccc2)OCCOCCOCCCCCO1 |
| InChI | InChI=1S/C19H28O6/c20-19-16-23-15-18(17-7-3-1-4-8-17)24-14-13-22-12-11-21-9-5-2-6-10-25-19/h1,3-4,7-8,18H,2,5-6,9-16H2 |
| InChIKey | LXMOYMWRAHFMJK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |