C12H20O8 — CID 102445385
1,3,6,9,12,15-hexaoxacyclooctadecane-10,14-dione (PubChem CID 102445385) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is 1,3,6,9,12,15-hexaoxacyclooctadecane-10,14-dione.
| Compound Name | 1,3,6,9,12,15-hexaoxacyclooctadecane-10,14-dione |
|---|---|
| PubChem CID | 102445385 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1,3,6,9,12,15-hexaoxacyclooctadecane-10,14-dione |
| SMILES | O=C1COCC(=O)OCCOCCOCOCCCO1 |
| InChI | InChI=1S/C12H20O8/c13-11-8-18-9-12(14)20-7-6-15-4-5-17-10-16-2-1-3-19-11/h1-10H2 |
| InChIKey | SQWNLUQMHMQMBH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |