About ethane;2-phenyloxirane
ethane;2-phenyloxirane (PubChem CID 54171856) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is ethane;2-phenyloxirane.
Molecular Properties
| Compound Name | ethane;2-phenyloxirane |
| PubChem CID | 54171856 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | ethane;2-phenyloxirane |
| SMILES | CC.c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C8H8O.C2H6/c1-2-4-7(5-3-1)8-6-9-8;1-2/h1-5,8H,6H2;1-2H3 |
| InChIKey | OVOPDOKJKNHEFH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenyloxirane?
The IUPAC name of ethane;2-phenyloxirane (CID 54171856) is ethane;2-phenyloxirane.
What is the SMILES notation for ethane;2-phenyloxirane?
The canonical SMILES for ethane;2-phenyloxirane is CC.c1ccc(C2CO2)cc1.
What is the InChIKey of ethane;2-phenyloxirane?
The InChIKey is OVOPDOKJKNHEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H6/c1-2-4-7(5-3-1)8-6-9-8;1-2/h1-5,8H,6H2;1-2H3.
What are the key properties of ethane;2-phenyloxirane?
ethane;2-phenyloxirane has a molecular weight of 150.22 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenyloxirane is sourced from PubChem (CID 54171856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).