C8H12O4 — CID 11708136
1,5-dioxecane-2,4-dione (PubChem CID 11708136) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1,5-dioxecane-2,4-dione.
| Compound Name | 1,5-dioxecane-2,4-dione |
|---|---|
| PubChem CID | 11708136 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1,5-dioxecane-2,4-dione |
| SMILES | O=C1CC(=O)OCCCCCO1 |
| InChI | InChI=1S/C8H12O4/c9-7-6-8(10)12-5-3-1-2-4-11-7/h1-6H2 |
| InChIKey | SSEPPSYDJURDAF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|