C21H34O8 — CID 175398471
1,6-dioxacyclopentadecane-7,15-dione;1,6-dioxecane-2,5-dione (PubChem CID 175398471) has the molecular formula C21H34O8 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1,6-dioxacyclopentadecane-7,15-dione;1,6-dioxecane-2,5-dione.
| Compound Name | 1,6-dioxacyclopentadecane-7,15-dione;1,6-dioxecane-2,5-dione |
|---|---|
| PubChem CID | 175398471 |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1,6-dioxacyclopentadecane-7,15-dione;1,6-dioxecane-2,5-dione |
| SMILES | O=C1CCC(=O)OCCCCO1.O=C1CCCCCCCC(=O)OCCCCO1 |
| InChI | InChI=1S/C13H22O4.C8H12O4/c14-12-8-4-2-1-3-5-9-13(15)17-11-7-6-10-16-12;9-7-3-4-8(10)12-6-2-1-5-11-7/h1-11H2;1-6H2 |
| InChIKey | JWXARVGCJDSKHD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|