C11H18O4 — CID 70450916
1,6-dioxacyclotridecane-7,13-dione (PubChem CID 70450916) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1,6-dioxacyclotridecane-7,13-dione.
| Compound Name | 1,6-dioxacyclotridecane-7,13-dione |
|---|---|
| PubChem CID | 70450916 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1,6-dioxacyclotridecane-7,13-dione |
| SMILES | O=C1CCCCCC(=O)OCCCCO1 |
| InChI | InChI=1S/C11H18O4/c12-10-6-2-1-3-7-11(13)15-9-5-4-8-14-10/h1-9H2 |
| InChIKey | MYGZACOEWRLGQM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |