C14H24O4 — CID 22483454
1,6-dioxacyclohexadecane-2,5-dione (PubChem CID 22483454) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1,6-dioxacyclohexadecane-2,5-dione.
| Compound Name | 1,6-dioxacyclohexadecane-2,5-dione |
|---|---|
| PubChem CID | 22483454 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1,6-dioxacyclohexadecane-2,5-dione |
| SMILES | O=C1CCC(=O)OCCCCCCCCCCO1 |
| InChI | InChI=1S/C14H24O4/c15-13-9-10-14(16)18-12-8-6-4-2-1-3-5-7-11-17-13/h1-12H2 |
| InChIKey | QWUVDMOLNYRJTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |