C9H13Cl3O4 — CID 174729760
chloroform;1,6-dioxecane-2,5-dione (PubChem CID 174729760) has the molecular formula C9H13Cl3O4 and a molecular weight of 291.56 g/mol. Its IUPAC name is chloroform;1,6-dioxecane-2,5-dione.
| Compound Name | chloroform;1,6-dioxecane-2,5-dione |
|---|---|
| PubChem CID | 174729760 |
| Molecular Formula | C9H13Cl3O4 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | chloroform;1,6-dioxecane-2,5-dione |
| SMILES | ClC(Cl)Cl.O=C1CCC(=O)OCCCCO1 |
| InChI | InChI=1S/C8H12O4.CHCl3/c9-7-3-4-8(10)12-6-2-1-5-11-7;2-1(3)4/h1-6H2;1H |
| InChIKey | MCOPJIGOVJJZOB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|