C8H14N3O4+ — CID 175181810
diiminoazanium;1,6-dioxecane-2,5-dione (PubChem CID 175181810) has the molecular formula C8H14N3O4+ and a molecular weight of 216.22 g/mol. Its IUPAC name is diiminoazanium;1,6-dioxecane-2,5-dione.
| Compound Name | diiminoazanium;1,6-dioxecane-2,5-dione |
|---|---|
| PubChem CID | 175181810 |
| Molecular Formula | C8H14N3O4+ |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | diiminoazanium;1,6-dioxecane-2,5-dione |
| SMILES | N=[N+]=N.O=C1CCC(=O)OCCCCO1 |
| InChI | InChI=1S/C8H12O4.H2N3/c9-7-3-4-8(10)12-6-2-1-5-11-7;1-3-2/h1-6H2;1-2H/q;+1 |
| InChIKey | TXODZAZSGUWUMY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|