C18H32O4 — CID 15642894
1,11-dioxacycloicosane-2,12-dione (PubChem CID 15642894) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1,11-dioxacycloicosane-2,12-dione.
| Compound Name | 1,11-dioxacycloicosane-2,12-dione |
|---|---|
| PubChem CID | 15642894 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 1,11-dioxacycloicosane-2,12-dione |
| SMILES | O=C1CCCCCCCCOC(=O)CCCCCCCCO1 |
| InChI | InChI=1S/C18H32O4/c19-17-13-9-5-1-3-7-11-15-21-18(20)14-10-6-2-4-8-12-16-22-17/h1-16H2 |
| InChIKey | KDZSXENKORTDQS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |