C12H14O2 — CID 10607707
(4R,5R)-5-methyl-4-phenyloxan-2-one (PubChem CID 10607707) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4R,5R)-5-methyl-4-phenyloxan-2-one.
| Compound Name | (4R,5R)-5-methyl-4-phenyloxan-2-one |
|---|---|
| PubChem CID | 10607707 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (4R,5R)-5-methyl-4-phenyloxan-2-one |
| SMILES | C[C@H]1COC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-9-8-14-12(13)7-11(9)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | OPPRBNGMJKZJFX-GXSJLCMTSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |