C12H16 — CID 142373098
[(1R,3S)-2,3-dimethylcyclobutyl]benzene (PubChem CID 142373098) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is [(1R,3S)-2,3-dimethylcyclobutyl]benzene.
| Compound Name | [(1R,3S)-2,3-dimethylcyclobutyl]benzene |
|---|---|
| PubChem CID | 142373098 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | [(1R,3S)-2,3-dimethylcyclobutyl]benzene |
| SMILES | CC1[C@@H](C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16/c1-9-8-12(10(9)2)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3/t9-,10?,12+/m0/s1 |
| InChIKey | HHXBDNJRCNTZRS-VXFCFVAISA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |