C13H16O — CID 131136395
(1R,3R,5S)-3-methyl-2-methylidene-5-phenylcyclopentan-1-ol (PubChem CID 131136395) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (1R,3R,5S)-3-methyl-2-methylidene-5-phenylcyclopentan-1-ol.
| Compound Name | (1R,3R,5S)-3-methyl-2-methylidene-5-phenylcyclopentan-1-ol |
|---|---|
| PubChem CID | 131136395 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1R,3R,5S)-3-methyl-2-methylidene-5-phenylcyclopentan-1-ol |
| SMILES | C=C1[C@H](C)C[C@@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C13H16O/c1-9-8-12(13(14)10(9)2)11-6-4-3-5-7-11/h3-7,9,12-14H,2,8H2,1H3/t9-,12+,13+/m1/s1 |
| InChIKey | CMMUUTJHRLPMGQ-ICCXJUOJSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|