C18H20O2 — CID 98598015
(1R,2R,3R,6S)-3,6-diphenylcyclohexane-1,2-diol (PubChem CID 98598015) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (1R,2R,3R,6S)-3,6-diphenylcyclohexane-1,2-diol.
| Compound Name | (1R,2R,3R,6S)-3,6-diphenylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 98598015 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (1R,2R,3R,6S)-3,6-diphenylcyclohexane-1,2-diol |
| SMILES | O[C@H]1[C@H](O)[C@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c19-17-15(13-7-3-1-4-8-13)11-12-16(18(17)20)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16+,17-,18-/m1/s1 |
| InChIKey | KIDYUEHQXIEBGK-XMTFNYHQSA-N |
| XLogP | 3.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |