C24H24 — CID 100933620
[(1S,2S,5R)-2,5-diphenylcyclohexyl]benzene (PubChem CID 100933620) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is [(1S,2S,5R)-2,5-diphenylcyclohexyl]benzene.
| Compound Name | [(1S,2S,5R)-2,5-diphenylcyclohexyl]benzene |
|---|---|
| PubChem CID | 100933620 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(1S,2S,5R)-2,5-diphenylcyclohexyl]benzene |
| SMILES | c1ccc([C@@H]2CC[C@H](c3ccccc3)[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H24/c1-4-10-19(11-5-1)22-16-17-23(20-12-6-2-7-13-20)24(18-22)21-14-8-3-9-15-21/h1-15,22-24H,16-18H2/t22-,23-,24-/m1/s1 |
| InChIKey | JHBVMWSBRRWIJQ-WXFUMESZSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |