About benzene;cyclopropylbenzene
benzene;cyclopropylbenzene (PubChem CID 144638417) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is benzene;cyclopropylbenzene.
Molecular Properties
| Compound Name | benzene;cyclopropylbenzene |
| PubChem CID | 144638417 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | benzene;cyclopropylbenzene |
| SMILES | c1ccc(C2CC2)cc1.c1ccccc1 |
| InChI | InChI=1S/C9H10.C6H6/c1-2-4-8(5-3-1)9-6-7-9;1-2-4-6-5-3-1/h1-5,9H,6-7H2;1-6H |
| InChIKey | OTMUMRSULXYDRF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;cyclopropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;cyclopropylbenzene?
The IUPAC name of benzene;cyclopropylbenzene (CID 144638417) is benzene;cyclopropylbenzene.
What is the SMILES notation for benzene;cyclopropylbenzene?
The canonical SMILES for benzene;cyclopropylbenzene is c1ccc(C2CC2)cc1.c1ccccc1.
What is the InChIKey of benzene;cyclopropylbenzene?
The InChIKey is OTMUMRSULXYDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C6H6/c1-2-4-8(5-3-1)9-6-7-9;1-2-4-6-5-3-1/h1-5,9H,6-7H2;1-6H.
What are the key properties of benzene;cyclopropylbenzene?
benzene;cyclopropylbenzene has a molecular weight of 196.29 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;cyclopropylbenzene is sourced from PubChem (CID 144638417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).