C18H28N2 — CID 62314935
4-N-(4-phenylcyclohexyl)cyclohexane-1,4-diamine (PubChem CID 62314935) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 4-N-(4-phenylcyclohexyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(4-phenylcyclohexyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 62314935 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 4-N-(4-phenylcyclohexyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NC2CCC(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C18H28N2/c19-16-8-12-18(13-9-16)20-17-10-6-15(7-11-17)14-4-2-1-3-5-14/h1-5,15-18,20H,6-13,19H2 |
| InChIKey | XVKFUJSPAQZUCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |