About cyclopropylbenzene;ethylhydrazine
cyclopropylbenzene;ethylhydrazine (PubChem CID 22346635) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is cyclopropylbenzene;ethylhydrazine.
Molecular Properties
| Compound Name | cyclopropylbenzene;ethylhydrazine |
| PubChem CID | 22346635 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | cyclopropylbenzene;ethylhydrazine |
| SMILES | CCNN.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C9H10.C2H8N2/c1-2-4-8(5-3-1)9-6-7-9;1-2-4-3/h1-5,9H,6-7H2;4H,2-3H2,1H3 |
| InChIKey | APMNFDSVKRRCRZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylbenzene;ethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylbenzene;ethylhydrazine?
The IUPAC name of cyclopropylbenzene;ethylhydrazine (CID 22346635) is cyclopropylbenzene;ethylhydrazine.
What is the SMILES notation for cyclopropylbenzene;ethylhydrazine?
The canonical SMILES for cyclopropylbenzene;ethylhydrazine is CCNN.c1ccc(C2CC2)cc1.
What is the InChIKey of cyclopropylbenzene;ethylhydrazine?
The InChIKey is APMNFDSVKRRCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C2H8N2/c1-2-4-8(5-3-1)9-6-7-9;1-2-4-3/h1-5,9H,6-7H2;4H,2-3H2,1H3.
What are the key properties of cyclopropylbenzene;ethylhydrazine?
cyclopropylbenzene;ethylhydrazine has a molecular weight of 178.28 g/mol, XLogP of 2.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylbenzene;ethylhydrazine is sourced from PubChem (CID 22346635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).