About CID 159076923
CID 159076923 (PubChem CID 159076923) has the molecular formula C12H16Li
and a molecular weight of 167.20 g/mol.
Molecular Properties
| Compound Name | CID 159076923 |
| PubChem CID | 159076923 |
| Molecular Formula | C12H16Li |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | — |
| SMILES | [Li].c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1,3-4,7-8,12H,2,5-6,9-10H2; |
| InChIKey | KAJDOKRVEXEJEL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 159076923 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159076923?
The IUPAC name of CID 159076923 (CID 159076923) is not available.
What is the SMILES notation for CID 159076923?
The canonical SMILES for CID 159076923 is [Li].c1ccc(C2CCCCC2)cc1.
What is the InChIKey of CID 159076923?
The InChIKey is KAJDOKRVEXEJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1,3-4,7-8,12H,2,5-6,9-10H2;.
What are the key properties of CID 159076923?
CID 159076923 has a molecular weight of 167.20 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159076923 is sourced from PubChem (CID 159076923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).