About 1-cyclohexyl-4-methylbenzene;toluene
1-cyclohexyl-4-methylbenzene;toluene (PubChem CID 143243711) has the molecular formula C20H26
and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-cyclohexyl-4-methylbenzene;toluene.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-methylbenzene;toluene |
| PubChem CID | 143243711 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-cyclohexyl-4-methylbenzene;toluene |
| SMILES | Cc1ccc(C2CCCCC2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C13H18.C7H8/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-5-3-2-4-6-7/h7-10,12H,2-6H2,1H3;2-6H,1H3 |
| InChIKey | REVRLHSBJGVNMR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclohexyl-4-methylbenzene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-methylbenzene;toluene?
The IUPAC name of 1-cyclohexyl-4-methylbenzene;toluene (CID 143243711) is 1-cyclohexyl-4-methylbenzene;toluene.
What is the SMILES notation for 1-cyclohexyl-4-methylbenzene;toluene?
The canonical SMILES for 1-cyclohexyl-4-methylbenzene;toluene is Cc1ccc(C2CCCCC2)cc1.Cc1ccccc1.
What is the InChIKey of 1-cyclohexyl-4-methylbenzene;toluene?
The InChIKey is REVRLHSBJGVNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18.C7H8/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-5-3-2-4-6-7/h7-10,12H,2-6H2,1H3;2-6H,1H3.
What are the key properties of 1-cyclohexyl-4-methylbenzene;toluene?
1-cyclohexyl-4-methylbenzene;toluene has a molecular weight of 266.43 g/mol, XLogP of 6.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-methylbenzene;toluene is sourced from PubChem (CID 143243711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).