About 1-cyclopropyl-4-methylbenzene;ethane;methane
1-cyclopropyl-4-methylbenzene;ethane;methane (PubChem CID 164862835) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-cyclopropyl-4-methylbenzene;ethane;methane.
Molecular Properties
| Compound Name | 1-cyclopropyl-4-methylbenzene;ethane;methane |
| PubChem CID | 164862835 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-cyclopropyl-4-methylbenzene;ethane;methane |
| SMILES | C.CC.Cc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C10H12.C2H6.CH4/c1-8-2-4-9(5-3-8)10-6-7-10;1-2;/h2-5,10H,6-7H2,1H3;1-2H3;1H4 |
| InChIKey | CLHIVCLVGOQGQE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopropyl-4-methylbenzene;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4-methylbenzene;ethane;methane?
The IUPAC name of 1-cyclopropyl-4-methylbenzene;ethane;methane (CID 164862835) is 1-cyclopropyl-4-methylbenzene;ethane;methane.
What is the SMILES notation for 1-cyclopropyl-4-methylbenzene;ethane;methane?
The canonical SMILES for 1-cyclopropyl-4-methylbenzene;ethane;methane is C.CC.Cc1ccc(C2CC2)cc1.
What is the InChIKey of 1-cyclopropyl-4-methylbenzene;ethane;methane?
The InChIKey is CLHIVCLVGOQGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C2H6.CH4/c1-8-2-4-9(5-3-8)10-6-7-10;1-2;/h2-5,10H,6-7H2,1H3;1-2H3;1H4.
What are the key properties of 1-cyclopropyl-4-methylbenzene;ethane;methane?
1-cyclopropyl-4-methylbenzene;ethane;methane has a molecular weight of 178.32 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4-methylbenzene;ethane;methane is sourced from PubChem (CID 164862835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).