C46H46O2P2 — CID 90141834
1-[[4-[4-[4-bis(4-methylphenyl)phosphorylphenyl]cyclohexyl]phenyl]-(4-methylphenyl)phosphoryl]-4-methylbenzene (PubChem CID 90141834) has the molecular formula C46H46O2P2 and a molecular weight of 692.82 g/mol. Its IUPAC name is 1-[[4-[4-[4-bis(4-methylphenyl)phosphorylphenyl]cyclohexyl]phenyl]-(4-methylphenyl)phosphoryl]-4-methylbenzene.
| Compound Name | 1-[[4-[4-[4-bis(4-methylphenyl)phosphorylphenyl]cyclohexyl]phenyl]-(4-methylphenyl)phosphoryl]-4-methylbenzene |
|---|---|
| PubChem CID | 90141834 |
| Molecular Formula | C46H46O2P2 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | 1-[[4-[4-[4-bis(4-methylphenyl)phosphorylphenyl]cyclohexyl]phenyl]-(4-methylphenyl)phosphoryl]-4-methylbenzene |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)c2ccc(C3CCC(c4ccc(P(=O)(c5ccc(C)cc5)c5ccc(C)cc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C46H46O2P2/c1-33-5-21-41(22-6-33)49(47,42-23-7-34(2)8-24-42)45-29-17-39(18-30-45)37-13-15-38(16-14-37)40-19-31-46(32-20-40)50(48,43-25-9-35(3)10-26-43)44-27-11-36(4)12-28-44/h5-12,17-32,37-38H,13-16H2,1-4H3 |
| InChIKey | FTNFCUGNIWYBSE-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|