C11H16O — CID 143290478
1-cyclopropyl-4-methylbenzene;methanol (PubChem CID 143290478) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-cyclopropyl-4-methylbenzene;methanol.
| Compound Name | 1-cyclopropyl-4-methylbenzene;methanol |
|---|---|
| PubChem CID | 143290478 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-cyclopropyl-4-methylbenzene;methanol |
| SMILES | CO.Cc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C10H12.CH4O/c1-8-2-4-9(5-3-8)10-6-7-10;1-2/h2-5,10H,6-7H2,1H3;2H,1H3 |
| InChIKey | ICUCSAKEHHWFOY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |