About 4-(4-methylphenyl)oxane
4-(4-methylphenyl)oxane (PubChem CID 46222621) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-(4-methylphenyl)oxane.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)oxane |
| PubChem CID | 46222621 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-(4-methylphenyl)oxane |
| SMILES | Cc1ccc(C2CCOCC2)cc1 |
| InChI | InChI=1S/C12H16O/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h2-5,12H,6-9H2,1H3 |
| InChIKey | NXQLPRWNPQVHTO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-methylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)oxane?
The IUPAC name of 4-(4-methylphenyl)oxane (CID 46222621) is 4-(4-methylphenyl)oxane.
What is the SMILES notation for 4-(4-methylphenyl)oxane?
The canonical SMILES for 4-(4-methylphenyl)oxane is Cc1ccc(C2CCOCC2)cc1.
What is the InChIKey of 4-(4-methylphenyl)oxane?
The InChIKey is NXQLPRWNPQVHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12/h2-5,12H,6-9H2,1H3.
What are the key properties of 4-(4-methylphenyl)oxane?
4-(4-methylphenyl)oxane has a molecular weight of 176.26 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)oxane is sourced from PubChem (CID 46222621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).