About ethane;4-(4-ethylphenyl)oxane
ethane;4-(4-ethylphenyl)oxane (PubChem CID 145044637) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;4-(4-ethylphenyl)oxane.
Molecular Properties
| Compound Name | ethane;4-(4-ethylphenyl)oxane |
| PubChem CID | 145044637 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | ethane;4-(4-ethylphenyl)oxane |
| SMILES | CC.CCc1ccc(C2CCOCC2)cc1 |
| InChI | InChI=1S/C13H18O.C2H6/c1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13;1-2/h3-6,13H,2,7-10H2,1H3;1-2H3 |
| InChIKey | AVUZREQZKAGKJC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(4-ethylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-ethylphenyl)oxane?
The IUPAC name of ethane;4-(4-ethylphenyl)oxane (CID 145044637) is ethane;4-(4-ethylphenyl)oxane.
What is the SMILES notation for ethane;4-(4-ethylphenyl)oxane?
The canonical SMILES for ethane;4-(4-ethylphenyl)oxane is CC.CCc1ccc(C2CCOCC2)cc1.
What is the InChIKey of ethane;4-(4-ethylphenyl)oxane?
The InChIKey is AVUZREQZKAGKJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C2H6/c1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13;1-2/h3-6,13H,2,7-10H2,1H3;1-2H3.
What are the key properties of ethane;4-(4-ethylphenyl)oxane?
ethane;4-(4-ethylphenyl)oxane has a molecular weight of 220.36 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-ethylphenyl)oxane is sourced from PubChem (CID 145044637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).