C22H30 — CID 174429743
cyclohexylbenzene;1,4-diethylbenzene (PubChem CID 174429743) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is cyclohexylbenzene;1,4-diethylbenzene.
| Compound Name | cyclohexylbenzene;1,4-diethylbenzene |
|---|---|
| PubChem CID | 174429743 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | cyclohexylbenzene;1,4-diethylbenzene |
| SMILES | CCc1ccc(CC)cc1.c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16.C10H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-9-5-7-10(4-2)8-6-9/h1,3-4,7-8,12H,2,5-6,9-10H2;5-8H,3-4H2,1-2H3 |
| InChIKey | VIRABTSVHGKULA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |