About cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene
cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene (PubChem CID 142052735) has the molecular formula C23H36
and a molecular weight of 312.54 g/mol. Its IUPAC name is cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene.
Molecular Properties
| Compound Name | cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene |
| PubChem CID | 142052735 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene |
| SMILES | CC.CC.CCc1cccc(C)c1.c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C10H12.C9H12.2C2H6/c1-2-5-9(6-3-1)10-7-4-8-10;1-3-9-6-4-5-8(2)7-9;2*1-2/h1-3,5-6,10H,4,7-8H2;4-7H,3H2,1-2H3;2*1-2H3 |
| InChIKey | MZCFRJDPYFYHNR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene?
The IUPAC name of cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene (CID 142052735) is cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene.
What is the SMILES notation for cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene?
The canonical SMILES for cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene is CC.CC.CCc1cccc(C)c1.c1ccc(C2CCC2)cc1.
What is the InChIKey of cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene?
The InChIKey is MZCFRJDPYFYHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C9H12.2C2H6/c1-2-5-9(6-3-1)10-7-4-8-10;1-3-9-6-4-5-8(2)7-9;2*1-2/h1-3,5-6,10H,4,7-8H2;4-7H,3H2,1-2H3;2*1-2H3.
What are the key properties of cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene?
cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene has a molecular weight of 312.54 g/mol, XLogP of 7.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylbenzene;ethane;1-ethyl-3-methylbenzene is sourced from PubChem (CID 142052735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).