About ethane;1-ethyl-3-methylbenzene;formaldehyde
ethane;1-ethyl-3-methylbenzene;formaldehyde (PubChem CID 172563625) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylbenzene;formaldehyde.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-methylbenzene;formaldehyde |
| PubChem CID | 172563625 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | ethane;1-ethyl-3-methylbenzene;formaldehyde |
| SMILES | C=O.CC.CC.CCc1cccc(C)c1 |
| InChI | InChI=1S/C9H12.2C2H6.CH2O/c1-3-9-6-4-5-8(2)7-9;3*1-2/h4-7H,3H2,1-2H3;2*1-2H3;1H2 |
| InChIKey | IDVVIQKNOUFWJA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-3-methylbenzene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-methylbenzene;formaldehyde?
The IUPAC name of ethane;1-ethyl-3-methylbenzene;formaldehyde (CID 172563625) is ethane;1-ethyl-3-methylbenzene;formaldehyde.
What is the SMILES notation for ethane;1-ethyl-3-methylbenzene;formaldehyde?
The canonical SMILES for ethane;1-ethyl-3-methylbenzene;formaldehyde is C=O.CC.CC.CCc1cccc(C)c1.
What is the InChIKey of ethane;1-ethyl-3-methylbenzene;formaldehyde?
The InChIKey is IDVVIQKNOUFWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C2H6.CH2O/c1-3-9-6-4-5-8(2)7-9;3*1-2/h4-7H,3H2,1-2H3;2*1-2H3;1H2.
What are the key properties of ethane;1-ethyl-3-methylbenzene;formaldehyde?
ethane;1-ethyl-3-methylbenzene;formaldehyde has a molecular weight of 210.36 g/mol, XLogP of 4.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-methylbenzene;formaldehyde is sourced from PubChem (CID 172563625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).