About 1-ethyl-3-methylbenzene;phenylbenzene;yttrium
1-ethyl-3-methylbenzene;phenylbenzene;yttrium (PubChem CID 161331275) has the molecular formula C21H20Y-2
and a molecular weight of 361.30 g/mol. Its IUPAC name is 1-ethyl-3-methylbenzene;phenylbenzene;yttrium.
Molecular Properties
| Compound Name | 1-ethyl-3-methylbenzene;phenylbenzene;yttrium |
| PubChem CID | 161331275 |
| Molecular Formula | C21H20Y-2 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-ethyl-3-methylbenzene;phenylbenzene;yttrium |
| SMILES | CCc1cccc(C)c1.[Y].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C12H8.C9H12.Y/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-9-6-4-5-8(2)7-9;/h1-7,9H;4-7H,3H2,1-2H3;/q-2;; |
| InChIKey | UPIZIBQDCNZSGU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylbenzene;phenylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylbenzene;phenylbenzene;yttrium?
The IUPAC name of 1-ethyl-3-methylbenzene;phenylbenzene;yttrium (CID 161331275) is 1-ethyl-3-methylbenzene;phenylbenzene;yttrium.
What is the SMILES notation for 1-ethyl-3-methylbenzene;phenylbenzene;yttrium?
The canonical SMILES for 1-ethyl-3-methylbenzene;phenylbenzene;yttrium is CCc1cccc(C)c1.[Y].[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of 1-ethyl-3-methylbenzene;phenylbenzene;yttrium?
The InChIKey is UPIZIBQDCNZSGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C9H12.Y/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-9-6-4-5-8(2)7-9;/h1-7,9H;4-7H,3H2,1-2H3;/q-2;;.
What are the key properties of 1-ethyl-3-methylbenzene;phenylbenzene;yttrium?
1-ethyl-3-methylbenzene;phenylbenzene;yttrium has a molecular weight of 361.30 g/mol, XLogP of 5.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylbenzene;phenylbenzene;yttrium is sourced from PubChem (CID 161331275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).