About 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine)
4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) (PubChem CID 172511088) has the molecular formula C36H32IrN4-2
and a molecular weight of 712.90 g/mol. Its IUPAC name is 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine).
Molecular Properties
| Compound Name | 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) |
| PubChem CID | 172511088 |
| Molecular Formula | C36H32IrN4-2 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 713.23 |
| IUPAC Name | 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) |
| SMILES | CCc1ccnc(-c2cc(CC)ccn2)c1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H16N2.2C11H8N.Ir/c1-3-11-5-7-15-13(9-11)14-10-12(4-2)6-8-16-14;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-10H,3-4H2,1-2H3;2*1-6,8-9H;/q;2*-1; |
| InChIKey | QCUXUWUZVHUSJJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine)?
The IUPAC name of 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) (CID 172511088) is 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine).
What is the SMILES notation for 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine)?
The canonical SMILES for 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) is CCc1ccnc(-c2cc(CC)ccn2)c1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine)?
The InChIKey is QCUXUWUZVHUSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.2C11H8N.Ir/c1-3-11-5-7-15-13(9-11)14-10-12(4-2)6-8-16-14;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-10H,3-4H2,1-2H3;2*1-6,8-9H;/q;2*-1;.
What are the key properties of 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine)?
4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) has a molecular weight of 712.90 g/mol, XLogP of 8.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(4-ethyl-2-pyridinyl)pyridine;iridium;bis(2-phenylpyridine) is sourced from PubChem (CID 172511088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).