About iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine)
iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) (PubChem CID 168726074) has the molecular formula C35H26IrN2-4
and a molecular weight of 666.82 g/mol. Its IUPAC name is iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine).
Molecular Properties
| Compound Name | iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) |
| PubChem CID | 168726074 |
| Molecular Formula | C35H26IrN2-4 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 667.17 |
| IUPAC Name | iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) |
| SMILES | Cc1ccc[c-]c1-c1[c-]cccc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C13H10.2C11H8N.Ir/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-8H,1H3;2*1-6,8-9H;/q-2;2*-1; |
| InChIKey | MUJTUZNJLPHTKR-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine)?
The IUPAC name of iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) (CID 168726074) is iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine).
What is the SMILES notation for iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine)?
The canonical SMILES for iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) is Cc1ccc[c-]c1-c1[c-]cccc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine)?
The InChIKey is MUJTUZNJLPHTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.2C11H8N.Ir/c1-11-7-5-6-10-13(11)12-8-3-2-4-9-12;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-8H,1H3;2*1-6,8-9H;/q-2;2*-1;.
What are the key properties of iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine)?
iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) has a molecular weight of 666.82 g/mol, XLogP of 8.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-methyl-2-phenylbenzene-3-ide;bis(2-phenylpyridine) is sourced from PubChem (CID 168726074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).