About chlorozinc(1+);2-phenylpyridine
chlorozinc(1+);2-phenylpyridine (PubChem CID 59773311) has the molecular formula C11H8ClNZn
and a molecular weight of 255.04 g/mol. Its IUPAC name is chlorozinc(1+);2-phenylpyridine.
Molecular Properties
| Compound Name | chlorozinc(1+);2-phenylpyridine |
| PubChem CID | 59773311 |
| Molecular Formula | C11H8ClNZn |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | chlorozinc(1+);2-phenylpyridine |
| SMILES | Cl[Zn+].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.ClH.Zn/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h1-6,8-9H;1H;/q-1;;+2/p-1 |
| InChIKey | ZJUYTHPYCGCNSE-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);2-phenylpyridine?
The IUPAC name of chlorozinc(1+);2-phenylpyridine (CID 59773311) is chlorozinc(1+);2-phenylpyridine.
What is the SMILES notation for chlorozinc(1+);2-phenylpyridine?
The canonical SMILES for chlorozinc(1+);2-phenylpyridine is Cl[Zn+].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of chlorozinc(1+);2-phenylpyridine?
The InChIKey is ZJUYTHPYCGCNSE-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H8N.ClH.Zn/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h1-6,8-9H;1H;/q-1;;+2/p-1.
What are the key properties of chlorozinc(1+);2-phenylpyridine?
chlorozinc(1+);2-phenylpyridine has a molecular weight of 255.04 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);2-phenylpyridine is sourced from PubChem (CID 59773311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).