About chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine
chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine (PubChem CID 54698144) has the molecular formula C22H17ClN2Pt
and a molecular weight of 539.92 g/mol. Its IUPAC name is chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine.
Molecular Properties
| Compound Name | chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine |
| PubChem CID | 54698144 |
| Molecular Formula | C22H17ClN2Pt |
| Molecular Weight | 539.92 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine |
| SMILES | Cl[Pt+].[c-]1ccccc1-c1ccccn1.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C11H9N.C11H8N.ClH.Pt/c2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h1-9H;1-6,8-9H;1H;/q;-1;;+2/p-1 |
| InChIKey | LEFIJJJDVKUMIX-UHFFFAOYSA-M |
| XLogP | 5.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine?
The IUPAC name of chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine (CID 54698144) is chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine.
What is the SMILES notation for chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine?
The canonical SMILES for chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine is Cl[Pt+].[c-]1ccccc1-c1ccccn1.c1ccc(-c2ccccn2)cc1.
What is the InChIKey of chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine?
The InChIKey is LEFIJJJDVKUMIX-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H9N.C11H8N.ClH.Pt/c2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h1-9H;1-6,8-9H;1H;/q;-1;;+2/p-1.
What are the key properties of chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine?
chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine has a molecular weight of 539.92 g/mol, XLogP of 5.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum(1+);2-phenylpyridine;2-phenylpyridine is sourced from PubChem (CID 54698144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).