About bromonickel;2-phenyl-6-pyridin-2-ylpyridine
bromonickel;2-phenyl-6-pyridin-2-ylpyridine (PubChem CID 153499013) has the molecular formula C16H11BrN2Ni-
and a molecular weight of 369.88 g/mol. Its IUPAC name is bromonickel;2-phenyl-6-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | bromonickel;2-phenyl-6-pyridin-2-ylpyridine |
| PubChem CID | 153499013 |
| Molecular Formula | C16H11BrN2Ni- |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | bromonickel;2-phenyl-6-pyridin-2-ylpyridine |
| SMILES | [Ni]Br.[c-]1ccccc1-c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H11N2.BrH.Ni/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15;;/h1-7,9-12H;1H;/q-1;;+1/p-1 |
| InChIKey | ILUQJMBHFDUTDI-UHFFFAOYSA-M |
| XLogP | 4.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromonickel;2-phenyl-6-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromonickel;2-phenyl-6-pyridin-2-ylpyridine?
The IUPAC name of bromonickel;2-phenyl-6-pyridin-2-ylpyridine (CID 153499013) is bromonickel;2-phenyl-6-pyridin-2-ylpyridine.
What is the SMILES notation for bromonickel;2-phenyl-6-pyridin-2-ylpyridine?
The canonical SMILES for bromonickel;2-phenyl-6-pyridin-2-ylpyridine is [Ni]Br.[c-]1ccccc1-c1cccc(-c2ccccn2)n1.
What is the InChIKey of bromonickel;2-phenyl-6-pyridin-2-ylpyridine?
The InChIKey is ILUQJMBHFDUTDI-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H11N2.BrH.Ni/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15;;/h1-7,9-12H;1H;/q-1;;+1/p-1.
What are the key properties of bromonickel;2-phenyl-6-pyridin-2-ylpyridine?
bromonickel;2-phenyl-6-pyridin-2-ylpyridine has a molecular weight of 369.88 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromonickel;2-phenyl-6-pyridin-2-ylpyridine is sourced from PubChem (CID 153499013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).