C17H11ClNNi-2 — CID 153499161
chloronickel;2,6-di(phenyl)pyridine (PubChem CID 153499161) has the molecular formula C17H11ClNNi-2 and a molecular weight of 323.43 g/mol. Its IUPAC name is chloronickel;2,6-di(phenyl)pyridine.
| Compound Name | chloronickel;2,6-di(phenyl)pyridine |
|---|---|
| PubChem CID | 153499161 |
| Molecular Formula | C17H11ClNNi-2 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | chloronickel;2,6-di(phenyl)pyridine |
| SMILES | Cl[Ni].[c-]1ccccc1-c1cccc(-c2[c-]cccc2)n1 |
| InChI | InChI=1S/C17H11N.ClH.Ni/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15;;/h1-8,10,12-13H;1H;/q-2;;+1/p-1 |
| InChIKey | WNKHNCXOZOJJRL-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|