About palladium(2+);phenylbenzene
palladium(2+);phenylbenzene (PubChem CID 58471959) has the molecular formula C12H8Pd
and a molecular weight of 258.62 g/mol. Its IUPAC name is palladium(2+);phenylbenzene.
Molecular Properties
| Compound Name | palladium(2+);phenylbenzene |
| PubChem CID | 58471959 |
| Molecular Formula | C12H8Pd |
| Molecular Weight | 258.62 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | palladium(2+);phenylbenzene |
| SMILES | [Pd+2].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C12H8.Pd/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-7,9H;/q-2;+2 |
| InChIKey | HBNGIKFJEOHNTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);phenylbenzene?
The IUPAC name of palladium(2+);phenylbenzene (CID 58471959) is palladium(2+);phenylbenzene.
What is the SMILES notation for palladium(2+);phenylbenzene?
The canonical SMILES for palladium(2+);phenylbenzene is [Pd+2].[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of palladium(2+);phenylbenzene?
The InChIKey is HBNGIKFJEOHNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.Pd/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-7,9H;/q-2;+2.
What are the key properties of palladium(2+);phenylbenzene?
palladium(2+);phenylbenzene has a molecular weight of 258.62 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);phenylbenzene is sourced from PubChem (CID 58471959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).