About iridium;phenylbenzene
iridium;phenylbenzene (PubChem CID 58599975) has the molecular formula C24H16Ir-4
and a molecular weight of 496.61 g/mol. Its IUPAC name is iridium;phenylbenzene.
Molecular Properties
| Compound Name | iridium;phenylbenzene |
| PubChem CID | 58599975 |
| Molecular Formula | C24H16Ir-4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | iridium;phenylbenzene |
| SMILES | [Ir].[c-]1ccccc1-c1[c-]cccc1.[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/2C12H8.Ir/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h2*1-7,9H;/q2*-2; |
| InChIKey | YRJMXVUMBIRIHQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;phenylbenzene?
The IUPAC name of iridium;phenylbenzene (CID 58599975) is iridium;phenylbenzene.
What is the SMILES notation for iridium;phenylbenzene?
The canonical SMILES for iridium;phenylbenzene is [Ir].[c-]1ccccc1-c1[c-]cccc1.[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of iridium;phenylbenzene?
The InChIKey is YRJMXVUMBIRIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8.Ir/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h2*1-7,9H;/q2*-2;.
What are the key properties of iridium;phenylbenzene?
iridium;phenylbenzene has a molecular weight of 496.61 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;phenylbenzene is sourced from PubChem (CID 58599975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).