C18H10Y4-4 — CID 160503199
1,3-di(phenyl)benzene-4,6-diide;tetrakis(yttrium) (PubChem CID 160503199) has the molecular formula C18H10Y4-4 and a molecular weight of 581.90 g/mol. Its IUPAC name is 1,3-di(phenyl)benzene-4,6-diide;tetrakis(yttrium).
| Compound Name | 1,3-di(phenyl)benzene-4,6-diide;tetrakis(yttrium) |
|---|---|
| PubChem CID | 160503199 |
| Molecular Formula | C18H10Y4-4 |
| Molecular Weight | 581.90 g/mol |
| Exact Mass | 581.70 |
| IUPAC Name | 1,3-di(phenyl)benzene-4,6-diide;tetrakis(yttrium) |
| SMILES | [Y].[Y].[Y].[Y].[c-]1ccccc1-c1[c-]c[c-]c(-c2[c-]cccc2)c1 |
| InChI | InChI=1S/C18H10.4Y/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;;;;/h1-8,10,14H;;;;/q-4;;;; |
| InChIKey | NIZPDZLIJYLFJL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|