C12H6Y-2 — CID 164741490
2-phenylcyclohexa-1,3-dien-5-yne;yttrium (PubChem CID 164741490) has the molecular formula C12H6Y-2 and a molecular weight of 239.09 g/mol. Its IUPAC name is 2-phenylcyclohexa-1,3-dien-5-yne;yttrium.
| Compound Name | 2-phenylcyclohexa-1,3-dien-5-yne;yttrium |
|---|---|
| PubChem CID | 164741490 |
| Molecular Formula | C12H6Y-2 |
| Molecular Weight | 239.09 g/mol |
| Exact Mass | 238.95 |
| IUPAC Name | 2-phenylcyclohexa-1,3-dien-5-yne;yttrium |
| SMILES | [Y].c1[c-]c(-c2[c-]cccc2)ccc#1 |
| InChI | InChI=1S/C12H6.Y/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1,3-5,7,9H;/q-2; |
| InChIKey | PZADBOMPUCKWKC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|