About ethane;phenylbenzene;yttrium
ethane;phenylbenzene;yttrium (PubChem CID 161119758) has the molecular formula C20H32Y-2
and a molecular weight of 361.38 g/mol. Its IUPAC name is ethane;phenylbenzene;yttrium.
Molecular Properties
| Compound Name | ethane;phenylbenzene;yttrium |
| PubChem CID | 161119758 |
| Molecular Formula | C20H32Y-2 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | ethane;phenylbenzene;yttrium |
| SMILES | CC.CC.CC.CC.[Y].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C12H8.4C2H6.Y/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4*1-2;/h1-7,9H;4*1-2H3;/q-2;;;;; |
| InChIKey | SAWPZRCEMAWQOF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;phenylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenylbenzene;yttrium?
The IUPAC name of ethane;phenylbenzene;yttrium (CID 161119758) is ethane;phenylbenzene;yttrium.
What is the SMILES notation for ethane;phenylbenzene;yttrium?
The canonical SMILES for ethane;phenylbenzene;yttrium is CC.CC.CC.CC.[Y].[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of ethane;phenylbenzene;yttrium?
The InChIKey is SAWPZRCEMAWQOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.4C2H6.Y/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4*1-2;/h1-7,9H;4*1-2H3;/q-2;;;;;.
What are the key properties of ethane;phenylbenzene;yttrium?
ethane;phenylbenzene;yttrium has a molecular weight of 361.38 g/mol, XLogP of 7.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenylbenzene;yttrium is sourced from PubChem (CID 161119758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).