About ethane;palladium;2-phenylaniline
ethane;palladium;2-phenylaniline (PubChem CID 176694795) has the molecular formula C14H16NPd-
and a molecular weight of 304.71 g/mol. Its IUPAC name is ethane;palladium;2-phenylaniline.
Molecular Properties
| Compound Name | ethane;palladium;2-phenylaniline |
| PubChem CID | 176694795 |
| Molecular Formula | C14H16NPd- |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | ethane;palladium;2-phenylaniline |
| SMILES | CC.Nc1ccccc1-c1[c-]cccc1.[Pd] |
| InChI | InChI=1S/C12H10N.C2H6.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2;/h1-6,8-9H,13H2;1-2H3;/q-1;; |
| InChIKey | YKSIXLNUZNAEHY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;palladium;2-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;palladium;2-phenylaniline?
The IUPAC name of ethane;palladium;2-phenylaniline (CID 176694795) is ethane;palladium;2-phenylaniline.
What is the SMILES notation for ethane;palladium;2-phenylaniline?
The canonical SMILES for ethane;palladium;2-phenylaniline is CC.Nc1ccccc1-c1[c-]cccc1.[Pd].
What is the InChIKey of ethane;palladium;2-phenylaniline?
The InChIKey is YKSIXLNUZNAEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N.C2H6.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2;/h1-6,8-9H,13H2;1-2H3;/q-1;;.
What are the key properties of ethane;palladium;2-phenylaniline?
ethane;palladium;2-phenylaniline has a molecular weight of 304.71 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;palladium;2-phenylaniline is sourced from PubChem (CID 176694795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).