C24H20NPd- — CID 174222698
1,1'-biphenyl;palladium;2-phenylaniline (PubChem CID 174222698) has the molecular formula C24H20NPd- and a molecular weight of 428.85 g/mol. Its IUPAC name is 1,1'-biphenyl;palladium;2-phenylaniline.
| Compound Name | 1,1'-biphenyl;palladium;2-phenylaniline |
|---|---|
| PubChem CID | 174222698 |
| Molecular Formula | C24H20NPd- |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1,1'-biphenyl;palladium;2-phenylaniline |
| SMILES | Nc1ccccc1-c1[c-]cccc1.[Pd].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N.C12H10.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-6,8-9H,13H2;1-10H;/q-1;; |
| InChIKey | FYTKXYOZIVYXIQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|