About N-methyl-2-phenylaniline;palladium
N-methyl-2-phenylaniline;palladium (PubChem CID 142737599) has the molecular formula C13H12NPd-
and a molecular weight of 288.67 g/mol. Its IUPAC name is N-methyl-2-phenylaniline;palladium.
Molecular Properties
| Compound Name | N-methyl-2-phenylaniline;palladium |
| PubChem CID | 142737599 |
| Molecular Formula | C13H12NPd- |
| Molecular Weight | 288.67 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | N-methyl-2-phenylaniline;palladium |
| SMILES | CNc1ccccc1-c1[c-]cccc1.[Pd] |
| InChI | InChI=1S/C13H12N.Pd/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11;/h2-7,9-10,14H,1H3;/q-1; |
| InChIKey | LGOGKYJBOPWTJQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-phenylaniline;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-phenylaniline;palladium?
The IUPAC name of N-methyl-2-phenylaniline;palladium (CID 142737599) is N-methyl-2-phenylaniline;palladium.
What is the SMILES notation for N-methyl-2-phenylaniline;palladium?
The canonical SMILES for N-methyl-2-phenylaniline;palladium is CNc1ccccc1-c1[c-]cccc1.[Pd].
What is the InChIKey of N-methyl-2-phenylaniline;palladium?
The InChIKey is LGOGKYJBOPWTJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N.Pd/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11;/h2-7,9-10,14H,1H3;/q-1;.
What are the key properties of N-methyl-2-phenylaniline;palladium?
N-methyl-2-phenylaniline;palladium has a molecular weight of 288.67 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-phenylaniline;palladium is sourced from PubChem (CID 142737599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).