C25H40NPPd+2 — CID 156663337
N-methyl-2-phenylaniline;palladium(2+);tritert-butylphosphanium (PubChem CID 156663337) has the molecular formula C25H40NPPd+2 and a molecular weight of 492.00 g/mol. Its IUPAC name is N-methyl-2-phenylaniline;palladium(2+);tritert-butylphosphanium.
| Compound Name | N-methyl-2-phenylaniline;palladium(2+);tritert-butylphosphanium |
|---|---|
| PubChem CID | 156663337 |
| Molecular Formula | C25H40NPPd+2 |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-methyl-2-phenylaniline;palladium(2+);tritert-butylphosphanium |
| SMILES | CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C.CNc1ccccc1-c1[c-]cccc1.[Pd+2] |
| InChI | InChI=1S/C13H12N.C12H27P.Pd/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11;1-10(2,3)13(11(4,5)6)12(7,8)9;/h2-7,9-10,14H,1H3;1-9H3;/q-1;;+2/p+1 |
| InChIKey | JBMRXRXDGIODCV-UHFFFAOYSA-O |
| XLogP | 7.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|