C12H11NO4PdS — CID 166559034
hydrogen sulfate;palladium(2+);2-phenylaniline (PubChem CID 166559034) has the molecular formula C12H11NO4PdS and a molecular weight of 371.71 g/mol. Its IUPAC name is hydrogen sulfate;palladium(2+);2-phenylaniline.
| Compound Name | hydrogen sulfate;palladium(2+);2-phenylaniline |
|---|---|
| PubChem CID | 166559034 |
| Molecular Formula | C12H11NO4PdS |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | hydrogen sulfate;palladium(2+);2-phenylaniline |
| SMILES | Nc1ccccc1-c1[c-]cccc1.O=S(=O)([O-])O.[Pd+2] |
| InChI | InChI=1S/C12H10N.H2O4S.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h1-6,8-9H,13H2;(H2,1,2,3,4);/q-1;;+2/p-1 |
| InChIKey | QWSHAHWIBPWOHO-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|