hydrogen sulfate;palladium(2+);2-phenylaniline

C12H11NO4PdS — CID 166559034

IUPAChydrogen sulfate;palladium(2+);2-phenylaniline
SMILESNc1ccccc1-c1[c-]cccc1.O=S(=O)([O-])O.[Pd+2]
InChIInChI=1S/C12H10N.H2O4S.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h1-6,8-9H,13H2;(H2,1,2,3,4);/q-1;;+2/p-1
InChIKeyQWSHAHWIBPWOHO-UHFFFAOYSA-M
MW371.71 g/mol
LogP1.74
Rot. Bonds1

About hydrogen sulfate;palladium(2+);2-phenylaniline

hydrogen sulfate;palladium(2+);2-phenylaniline (PubChem CID 166559034) has the molecular formula C12H11NO4PdS and a molecular weight of 371.71 g/mol. Its IUPAC name is hydrogen sulfate;palladium(2+);2-phenylaniline.

Molecular Properties

Compound Namehydrogen sulfate;palladium(2+);2-phenylaniline
PubChem CID166559034
Molecular FormulaC12H11NO4PdS
Molecular Weight371.71 g/mol
Exact Mass370.94
IUPAC Namehydrogen sulfate;palladium(2+);2-phenylaniline
SMILESNc1ccccc1-c1[c-]cccc1.O=S(=O)([O-])O.[Pd+2]
InChIInChI=1S/C12H10N.H2O4S.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h1-6,8-9H,13H2;(H2,1,2,3,4);/q-1;;+2/p-1
InChIKeyQWSHAHWIBPWOHO-UHFFFAOYSA-M
XLogP1.74
TPSA103.45 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.71
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze hydrogen sulfate;palladium(2+);2-phenylaniline with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfate;palladium(2+);2-phenylaniline?
The IUPAC name of hydrogen sulfate;palladium(2+);2-phenylaniline (CID 166559034) is hydrogen sulfate;palladium(2+);2-phenylaniline.
What is the SMILES notation for hydrogen sulfate;palladium(2+);2-phenylaniline?
The canonical SMILES for hydrogen sulfate;palladium(2+);2-phenylaniline is Nc1ccccc1-c1[c-]cccc1.O=S(=O)([O-])O.[Pd+2].
What is the InChIKey of hydrogen sulfate;palladium(2+);2-phenylaniline?
The InChIKey is QWSHAHWIBPWOHO-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10N.H2O4S.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h1-6,8-9H,13H2;(H2,1,2,3,4);/q-1;;+2/p-1.
What are the key properties of hydrogen sulfate;palladium(2+);2-phenylaniline?
hydrogen sulfate;palladium(2+);2-phenylaniline has a molecular weight of 371.71 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;palladium(2+);2-phenylaniline is sourced from PubChem (CID 166559034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).