C17H16O2Pt — CID 158441264
4-hydroxypent-3-en-2-one;phenylbenzene;platinum(2+) (PubChem CID 158441264) has the molecular formula C17H16O2Pt and a molecular weight of 447.39 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;phenylbenzene;platinum(2+).
| Compound Name | 4-hydroxypent-3-en-2-one;phenylbenzene;platinum(2+) |
|---|---|
| PubChem CID | 158441264 |
| Molecular Formula | C17H16O2Pt |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;phenylbenzene;platinum(2+) |
| SMILES | CC(=O)C=C(C)O.[Pt+2].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C12H8.C5H8O2.Pt/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4(6)3-5(2)7;/h1-7,9H;3,6H,1-2H3;/q-2;;+2 |
| InChIKey | ASUCPCQIMUCNKZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|