C22H18IrN3O2- — CID 161338404
4-hydroxypent-3-en-2-one;iridium;2-phenylpyrido[3,4-h]quinazoline (PubChem CID 161338404) has the molecular formula C22H18IrN3O2- and a molecular weight of 548.62 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;iridium;2-phenylpyrido[3,4-h]quinazoline.
| Compound Name | 4-hydroxypent-3-en-2-one;iridium;2-phenylpyrido[3,4-h]quinazoline |
|---|---|
| PubChem CID | 161338404 |
| Molecular Formula | C22H18IrN3O2- |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;iridium;2-phenylpyrido[3,4-h]quinazoline |
| SMILES | CC(=O)C=C(C)O.[Ir].[c-]1ccccc1-c1ncc2ccc3cnccc3c2n1 |
| InChI | InChI=1S/C17H10N3.C5H8O2.Ir/c1-2-4-12(5-3-1)17-19-11-14-7-6-13-10-18-9-8-15(13)16(14)20-17;1-4(6)3-5(2)7;/h1-4,6-11H;3,6H,1-2H3;/q-1;; |
| InChIKey | KIWRZWUXIWESHM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|