C24H20IrNO3- — CID 153460715
(Z)-4-hydroxypent-3-en-2-one;iridium;4-(phenoxy)benzo[f]isoquinoline (PubChem CID 153460715) has the molecular formula C24H20IrNO3- and a molecular weight of 562.65 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;4-(phenoxy)benzo[f]isoquinoline.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-(phenoxy)benzo[f]isoquinoline |
|---|---|
| PubChem CID | 153460715 |
| Molecular Formula | C24H20IrNO3- |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;4-(phenoxy)benzo[f]isoquinoline |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccccc1Oc1nccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C19H12NO.C5H8O2.Ir/c1-2-7-15(8-3-1)21-19-18-11-10-14-6-4-5-9-16(14)17(18)12-13-20-19;1-4(6)3-5(2)7;/h1-7,9-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | AOCUELSTLNUQEC-LWFKIUJUSA-N |
| XLogP | 6.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|