C22H24IrNO4- — CID 153461003
(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;7-(phenoxy)furo[2,3-c]pyridine (PubChem CID 153461003) has the molecular formula C22H24IrNO4- and a molecular weight of 558.65 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;7-(phenoxy)furo[2,3-c]pyridine.
| Compound Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;7-(phenoxy)furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 153461003 |
| Molecular Formula | C22H24IrNO4- |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;7-(phenoxy)furo[2,3-c]pyridine |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.[Ir].[c-]1ccccc1Oc1nccc2ccoc12 |
| InChI | InChI=1S/C13H8NO2.C9H16O2.Ir/c1-2-4-11(5-3-1)16-13-12-10(6-8-14-13)7-9-15-12;1-6(2)8(10)5-9(11)7(3)4;/h1-4,6-9H;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | ZBYVVEKUCFZBDS-QBBOVCHSSA-N |
| XLogP | 5.73 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|