C23H25IrN2O3- — CID 153460568
(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-(3H-pyridin-3-id-4-yloxy)isoquinoline (PubChem CID 153460568) has the molecular formula C23H25IrN2O3- and a molecular weight of 569.68 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-(3H-pyridin-3-id-4-yloxy)isoquinoline.
| Compound Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-(3H-pyridin-3-id-4-yloxy)isoquinoline |
|---|---|
| PubChem CID | 153460568 |
| Molecular Formula | C23H25IrN2O3- |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | (Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium;3-(3H-pyridin-3-id-4-yloxy)isoquinoline |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.[Ir].[c-]1cnccc1Oc1cc2ccccc2cn1 |
| InChI | InChI=1S/C14H9N2O.C9H16O2.Ir/c1-2-4-12-10-16-14(9-11(12)3-1)17-13-5-7-15-8-6-13;1-6(2)8(10)5-9(11)7(3)4;/h1-5,7-10H;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | HWAHKRBRWSEFNY-QBBOVCHSSA-N |
| XLogP | 5.53 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|